C18H15F3N2O7S — CID 162538497
methyl 3-[4-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]-2-nitrophenyl]-2-oxopropanoate (PubChem CID 162538497) has the molecular formula C18H15F3N2O7S and a molecular weight of 460.39 g/mol. Its IUPAC name is methyl 3-[4-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]-2-nitrophenyl]-2-oxopropanoate.
| Compound Name | methyl 3-[4-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]-2-nitrophenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 162538497 |
| Molecular Formula | C18H15F3N2O7S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | methyl 3-[4-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]-2-nitrophenyl]-2-oxopropanoate |
| SMILES | COC(=O)C(=O)Cc1ccc(S(=O)(=O)N(C)c2ccc(C(F)(F)F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15F3N2O7S/c1-22(13-6-4-12(5-7-13)18(19,20)21)31(28,29)14-8-3-11(15(10-14)23(26)27)9-16(24)17(25)30-2/h3-8,10H,9H2,1-2H3 |
| InChIKey | IPXPKOCGJGJBAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|