C15H8F6N2O3 — CID 168943128
6-amino-2,2-difluoro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 168943128) has the molecular formula C15H8F6N2O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 6-amino-2,2-difluoro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-2,2-difluoro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 168943128 |
| Molecular Formula | C15H8F6N2O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 6-amino-2,2-difluoro-N-[4-fluoro-3-(trifluoromethyl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)Nc1ccc(F)c(C(F)(F)F)c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H8F6N2O3/c16-9-2-1-6(3-8(9)14(17,18)19)23-13(24)7-4-11-12(5-10(7)22)26-15(20,21)25-11/h1-5H,22H2,(H,23,24) |
| InChIKey | OIWPXSSOZWSXEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|