C12H8F4N2OS — CID 61228423
3-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 61228423) has the molecular formula C12H8F4N2OS and a molecular weight of 304.27 g/mol. Its IUPAC name is 3-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61228423 |
| Molecular Formula | C12H8F4N2OS |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F4N2OS/c13-8-2-1-6(5-7(8)12(14,15)16)18-11(19)10-9(17)3-4-20-10/h1-5H,17H2,(H,18,19) |
| InChIKey | KCUKPQBRJXWJQV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |