C14H17NO — CID 121385100
2-methoxy-4-(2-phenylethyl)-1,2-dihydropyridine (PubChem CID 121385100) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methoxy-4-(2-phenylethyl)-1,2-dihydropyridine.
| Compound Name | 2-methoxy-4-(2-phenylethyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 121385100 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-methoxy-4-(2-phenylethyl)-1,2-dihydropyridine |
| SMILES | COC1C=C(CCc2ccccc2)C=CN1 |
| InChI | InChI=1S/C14H17NO/c1-16-14-11-13(9-10-15-14)8-7-12-5-3-2-4-6-12/h2-6,9-11,14-15H,7-8H2,1H3 |
| InChIKey | LIIKTCZXECAPIU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |