C12H13NO — CID 18975042
2-phenylmethoxy-1,2-dihydropyridine (PubChem CID 18975042) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-phenylmethoxy-1,2-dihydropyridine.
| Compound Name | 2-phenylmethoxy-1,2-dihydropyridine |
|---|---|
| PubChem CID | 18975042 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-phenylmethoxy-1,2-dihydropyridine |
| SMILES | C1=CNC(OCc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H13NO/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9,12-13H,10H2 |
| InChIKey | SUCOZZGXYYOLIM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |