C13H15NO — CID 173408525
(2S)-2-(2-phenylethoxy)-1,2-dihydropyridine (PubChem CID 173408525) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2S)-2-(2-phenylethoxy)-1,2-dihydropyridine.
| Compound Name | (2S)-2-(2-phenylethoxy)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173408525 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2S)-2-(2-phenylethoxy)-1,2-dihydropyridine |
| SMILES | C1=CN[C@@H](OCCc2ccccc2)C=C1 |
| InChI | InChI=1S/C13H15NO/c1-2-6-12(7-3-1)9-11-15-13-8-4-5-10-14-13/h1-8,10,13-14H,9,11H2/t13-/m0/s1 |
| InChIKey | DLYYSJSLHMGDEV-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |