C15H20ClN3O3S — CID 121389286
5-chloro-3-(2-methylsulfonylethyl)-1-piperidin-4-ylbenzimidazol-2-one (PubChem CID 121389286) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is 5-chloro-3-(2-methylsulfonylethyl)-1-piperidin-4-ylbenzimidazol-2-one.
| Compound Name | 5-chloro-3-(2-methylsulfonylethyl)-1-piperidin-4-ylbenzimidazol-2-one |
|---|---|
| PubChem CID | 121389286 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-chloro-3-(2-methylsulfonylethyl)-1-piperidin-4-ylbenzimidazol-2-one |
| SMILES | CS(=O)(=O)CCn1c(=O)n(C2CCNCC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H20ClN3O3S/c1-23(21,22)9-8-18-14-10-11(16)2-3-13(14)19(15(18)20)12-4-6-17-7-5-12/h2-3,10,12,17H,4-9H2,1H3 |
| InChIKey | COEGLJKRAFASCM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |