C16H20ClN3O3 — CID 130423889
4-(6-chloro-2-oxo-3-piperidin-4-ylbenzimidazol-1-yl)butanoic acid (PubChem CID 130423889) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-(6-chloro-2-oxo-3-piperidin-4-ylbenzimidazol-1-yl)butanoic acid.
| Compound Name | 4-(6-chloro-2-oxo-3-piperidin-4-ylbenzimidazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 130423889 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-(6-chloro-2-oxo-3-piperidin-4-ylbenzimidazol-1-yl)butanoic acid |
| SMILES | O=C(O)CCCn1c(=O)n(C2CCNCC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H20ClN3O3/c17-11-3-4-13-14(10-11)19(9-1-2-15(21)22)16(23)20(13)12-5-7-18-8-6-12/h3-4,10,12,18H,1-2,5-9H2,(H,21,22) |
| InChIKey | OSPHKQXIAHNSRP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |