C8H16N2O — CID 121391083
3-ethyl-N,N-dimethylazetidine-1-carboxamide (PubChem CID 121391083) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethylazetidine-1-carboxamide.
| Compound Name | 3-ethyl-N,N-dimethylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 121391083 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-ethyl-N,N-dimethylazetidine-1-carboxamide |
| SMILES | CCC1CN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C8H16N2O/c1-4-7-5-10(6-7)8(11)9(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | HHULAWOFUKKBSS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |