C21H43NO2 — CID 121392060
(E,2S,3R)-2-(ethylamino)-3-methoxyoctadec-4-en-1-ol (PubChem CID 121392060) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is (E,2S,3R)-2-(ethylamino)-3-methoxyoctadec-4-en-1-ol.
| Compound Name | (E,2S,3R)-2-(ethylamino)-3-methoxyoctadec-4-en-1-ol |
|---|---|
| PubChem CID | 121392060 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | (E,2S,3R)-2-(ethylamino)-3-methoxyoctadec-4-en-1-ol |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](OC)[C@H](CO)NCC |
| InChI | InChI=1S/C21H43NO2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-21(24-3)20(19-23)22-5-2/h17-18,20-23H,4-16,19H2,1-3H3/b18-17+/t20-,21+/m0/s1 |
| InChIKey | VOTMWLFNDDGMJD-BWMVHVDHSA-N |
| XLogP | 5.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|