C29H26N2O4S — CID 121393888
4-[2-[(4-methoxyphenyl)methoxy]-6-phenoxathiin-4-yl-4-pyridinyl]morpholine (PubChem CID 121393888) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is 4-[2-[(4-methoxyphenyl)methoxy]-6-phenoxathiin-4-yl-4-pyridinyl]morpholine.
| Compound Name | 4-[2-[(4-methoxyphenyl)methoxy]-6-phenoxathiin-4-yl-4-pyridinyl]morpholine |
|---|---|
| PubChem CID | 121393888 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 4-[2-[(4-methoxyphenyl)methoxy]-6-phenoxathiin-4-yl-4-pyridinyl]morpholine |
| SMILES | COc1ccc(COc2cc(N3CCOCC3)cc(-c3cccc4c3Oc3ccccc3S4)n2)cc1 |
| InChI | InChI=1S/C29H26N2O4S/c1-32-22-11-9-20(10-12-22)19-34-28-18-21(31-13-15-33-16-14-31)17-24(30-28)23-5-4-8-27-29(23)35-25-6-2-3-7-26(25)36-27/h2-12,17-18H,13-16,19H2,1H3 |
| InChIKey | KYVUEKMMKNCNMO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |