C28H26N4O3 — CID 121394374
4-morpholin-4-yl-6-[7-(pyridin-4-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one (PubChem CID 121394374) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(pyridin-4-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(pyridin-4-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394374 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(pyridin-4-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Oc2ccc(NCc4ccncc4)cc2C3)[nH]1 |
| InChI | InChI=1S/C28H26N4O3/c33-27-17-23(32-10-12-34-13-11-32)16-25(31-27)24-3-1-2-20-14-21-15-22(4-5-26(21)35-28(20)24)30-18-19-6-8-29-9-7-19/h1-9,15-17,30H,10-14,18H2,(H,31,33) |
| InChIKey | BIIOTQAJUZXYHY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |