C27H25N5O3 — CID 121394561
4-morpholin-4-yl-6-[7-(pyridazin-3-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one (PubChem CID 121394561) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(pyridazin-3-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(pyridazin-3-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121394561 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(pyridazin-3-ylmethylamino)-9H-xanthen-4-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Oc2ccc(NCc4cccnn4)cc2C3)[nH]1 |
| InChI | InChI=1S/C27H25N5O3/c33-26-16-22(32-9-11-34-12-10-32)15-24(30-26)23-5-1-3-18-13-19-14-20(6-7-25(19)35-27(18)23)28-17-21-4-2-8-29-31-21/h1-8,14-16,28H,9-13,17H2,(H,30,33) |
| InChIKey | YVDPWEKASCAVRK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |