C33H32N4O3 — CID 121467604
6-[7-[(5-cyclopent-2-en-1-yl-3-pyridinyl)methylamino]-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 121467604) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is 6-[7-[(5-cyclopent-2-en-1-yl-3-pyridinyl)methylamino]-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[7-[(5-cyclopent-2-en-1-yl-3-pyridinyl)methylamino]-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121467604 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 6-[7-[(5-cyclopent-2-en-1-yl-3-pyridinyl)methylamino]-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Oc2ccc(NCc4cncc(C5C=CCC5)c4)cc2C3)[nH]1 |
| InChI | InChI=1S/C33H32N4O3/c38-32-18-28(37-10-12-39-13-11-37)17-30(36-32)29-7-3-6-24-15-25-16-27(8-9-31(25)40-33(24)29)35-20-22-14-26(21-34-19-22)23-4-1-2-5-23/h1,3-4,6-9,14,16-19,21,23,35H,2,5,10-13,15,20H2,(H,36,38) |
| InChIKey | XKOOVXUXPVYGBJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|