C27H29N3O5 — CID 121394846
ethyl 2-[[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino]propanoate (PubChem CID 121394846) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is ethyl 2-[[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino]propanoate.
| Compound Name | ethyl 2-[[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 121394846 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl 2-[[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino]propanoate |
| SMILES | CCOC(=O)C(C)Nc1ccc2c(c1)Cc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1O2 |
| InChI | InChI=1S/C27H29N3O5/c1-3-34-27(32)17(2)28-20-7-8-24-19(14-20)13-18-5-4-6-22(26(18)35-24)23-15-21(16-25(31)29-23)30-9-11-33-12-10-30/h4-8,14-17,28H,3,9-13H2,1-2H3,(H,29,31) |
| InChIKey | CTRKEXBLVQGRAI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |