C15H28O2 — CID 121396018
3-(1-ethoxyethoxy)-2,4,7-trimethylocta-1,6-diene (PubChem CID 121396018) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-(1-ethoxyethoxy)-2,4,7-trimethylocta-1,6-diene.
| Compound Name | 3-(1-ethoxyethoxy)-2,4,7-trimethylocta-1,6-diene |
|---|---|
| PubChem CID | 121396018 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-(1-ethoxyethoxy)-2,4,7-trimethylocta-1,6-diene |
| SMILES | C=C(C)C(OC(C)OCC)C(C)CC=C(C)C |
| InChI | InChI=1S/C15H28O2/c1-8-16-14(7)17-15(12(4)5)13(6)10-9-11(2)3/h9,13-15H,4,8,10H2,1-3,5-7H3 |
| InChIKey | PPYHBXUNUIIXDI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|