C23H34O5S — CID 121397810
[(8R,9S,10R,13S,14S)-17-acetyl-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 121397810) has the molecular formula C23H34O5S and a molecular weight of 422.59 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-17-acetyl-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(8R,9S,10R,13S,14S)-17-acetyl-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 121397810 |
| Molecular Formula | C23H34O5S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-17-acetyl-6,10,13,16-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(=O)C1=C(C)C[C@H]2[C@@H]3CC(C)=C4CC(OS(=O)(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H34O5S/c1-13-10-17-18(7-9-23(5)20(17)11-14(2)21(23)15(3)24)22(4)8-6-16(12-19(13)22)28-29(25,26)27/h16-18,20H,6-12H2,1-5H3,(H,25,26,27)/t16?,17-,18+,20+,22-,23+/m1/s1 |
| InChIKey | OLKQCVJTUCDNNQ-BXMDGBPFSA-N |
| XLogP | 5.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|