C17H11Cl2NO4 — CID 121403500
(3-chlorophenyl)methyl 2-(5-chloro-2,3-dioxoindol-1-yl)acetate (PubChem CID 121403500) has the molecular formula C17H11Cl2NO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-(5-chloro-2,3-dioxoindol-1-yl)acetate.
| Compound Name | (3-chlorophenyl)methyl 2-(5-chloro-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 121403500 |
| Molecular Formula | C17H11Cl2NO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (3-chlorophenyl)methyl 2-(5-chloro-2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C(=O)c2cc(Cl)ccc21)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NO4/c18-11-3-1-2-10(6-11)9-24-15(21)8-20-14-5-4-12(19)7-13(14)16(22)17(20)23/h1-7H,8-9H2 |
| InChIKey | HSTPIVDJKNEIGR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|