C16H26O5 — CID 121404401
7-[(2S,4aR,5R,7aR)-2-hydroxy-2-methyl-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]heptanoic acid (PubChem CID 121404401) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 7-[(2S,4aR,5R,7aR)-2-hydroxy-2-methyl-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]heptanoic acid.
| Compound Name | 7-[(2S,4aR,5R,7aR)-2-hydroxy-2-methyl-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]heptanoic acid |
|---|---|
| PubChem CID | 121404401 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 7-[(2S,4aR,5R,7aR)-2-hydroxy-2-methyl-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]heptanoic acid |
| SMILES | C[C@@]1(O)CC[C@H]2[C@@H](CC(=O)[C@@H]2CCCCCCC(=O)O)O1 |
| InChI | InChI=1S/C16H26O5/c1-16(20)9-8-12-11(13(17)10-14(12)21-16)6-4-2-3-5-7-15(18)19/h11-12,14,20H,2-10H2,1H3,(H,18,19)/t11-,12-,14-,16+/m1/s1 |
| InChIKey | ODFOUVLELMNELZ-NCZKRNLISA-N |
| XLogP | 2.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|