C40H53N5O6S — CID 121407060
(2S)-2-[[(2S)-2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-[4-(4-propylcyclohexyl)piperidin-1-yl]pyrimidin-2-yl]phenyl]propanoyl]amino]butanedioic acid (PubChem CID 121407060) has the molecular formula C40H53N5O6S and a molecular weight of 731.96 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-[4-(4-propylcyclohexyl)piperidin-1-yl]pyrimidin-2-yl]phenyl]propanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-[4-(4-propylcyclohexyl)piperidin-1-yl]pyrimidin-2-yl]phenyl]propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 121407060 |
| Molecular Formula | C40H53N5O6S |
| Molecular Weight | 731.96 g/mol |
| Exact Mass | 731.37 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-[4-(4-propylcyclohexyl)piperidin-1-yl]pyrimidin-2-yl]phenyl]propanoyl]amino]butanedioic acid |
| SMILES | CCCC1CCC(C2CCN(c3cnc(-c4ccc(C[C@H](NC(=O)c5ccc(C(C)(C)C)s5)C(=O)N[C@@H](CC(=O)O)C(=O)O)cc4)nc3)CC2)CC1 |
| InChI | InChI=1S/C40H53N5O6S/c1-5-6-25-7-11-27(12-8-25)28-17-19-45(20-18-28)30-23-41-36(42-24-30)29-13-9-26(10-14-29)21-31(37(48)44-32(39(50)51)22-35(46)47)43-38(49)33-15-16-34(52-33)40(2,3)4/h9-10,13-16,23-25,27-28,31-32H,5-8,11-12,17-22H2,1-4H3,(H,43,49)(H,44,48)(H,46,47)(H,50,51)/t25?,27?,31-,32-/m0/s1 |
| InChIKey | UZFHXDFIHLMIEY-WALFHXNHSA-N |
| XLogP | 6.71 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |