C29H21F6N3O4 — CID 121407895
2-[6-[[(1R)-5-(trifluoromethyl)-4-[4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 121407895) has the molecular formula C29H21F6N3O4 and a molecular weight of 589.49 g/mol. Its IUPAC name is 2-[6-[[(1R)-5-(trifluoromethyl)-4-[4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[[(1R)-5-(trifluoromethyl)-4-[4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 121407895 |
| Molecular Formula | C29H21F6N3O4 |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 2-[6-[[(1R)-5-(trifluoromethyl)-4-[4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | O=C(O)CC1COc2cc(O[C@@H]3CCc4c3ccc(C(F)(F)F)c4-c3ccc(-c4n[nH]c(C(F)(F)F)n4)cc3)ccc21 |
| InChI | InChI=1S/C29H21F6N3O4/c30-28(31,32)21-9-7-19-20(25(21)14-1-3-15(4-2-14)26-36-27(38-37-26)29(33,34)35)8-10-22(19)42-17-5-6-18-16(11-24(39)40)13-41-23(18)12-17/h1-7,9,12,16,22H,8,10-11,13H2,(H,39,40)(H,36,37,38)/t16?,22-/m1/s1 |
| InChIKey | QTZLHNYDPDWDCN-VXNXSFHZSA-N |
| XLogP | 7.19 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |