C30H26F3N3O4 — CID 121408072
methyl 2-[6-[[(1R)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate (PubChem CID 121408072) has the molecular formula C30H26F3N3O4 and a molecular weight of 549.55 g/mol. Its IUPAC name is methyl 2-[6-[[(1R)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[6-[[(1R)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 121408072 |
| Molecular Formula | C30H26F3N3O4 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | methyl 2-[6-[[(1R)-4-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
| SMILES | COC(=O)CC1COc2cc(O[C@@H]3CCc4c3ccc(C(F)(F)F)c4-c3ccc(-c4n[nH]c(C)n4)cc3)ccc21 |
| InChI | InChI=1S/C30H26F3N3O4/c1-16-34-29(36-35-16)18-5-3-17(4-6-18)28-23-10-12-25(22(23)9-11-24(28)30(31,32)33)40-20-7-8-21-19(13-27(37)38-2)15-39-26(21)14-20/h3-9,11,14,19,25H,10,12-13,15H2,1-2H3,(H,34,35,36)/t19?,25-/m1/s1 |
| InChIKey | HBGKYDSUNSMRFJ-OPEAARRCSA-N |
| XLogP | 6.57 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |