C17H19N3O2 — CID 121413925
N-[(3R)-spiro[aziridine-3,2'-bicyclo[2.2.2]octane]-2-yl]furo[3,2-b]pyridine-5-carboxamide (PubChem CID 121413925) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(3R)-spiro[aziridine-3,2'-bicyclo[2.2.2]octane]-2-yl]furo[3,2-b]pyridine-5-carboxamide.
| Compound Name | N-[(3R)-spiro[aziridine-3,2'-bicyclo[2.2.2]octane]-2-yl]furo[3,2-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 121413925 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(3R)-spiro[aziridine-3,2'-bicyclo[2.2.2]octane]-2-yl]furo[3,2-b]pyridine-5-carboxamide |
| SMILES | O=C(NC1N[C@@]12CC1CCC2CC1)c1ccc2occc2n1 |
| InChI | InChI=1S/C17H19N3O2/c21-15(13-5-6-14-12(18-13)7-8-22-14)19-16-17(20-16)9-10-1-3-11(17)4-2-10/h5-8,10-11,16,20H,1-4,9H2,(H,19,21)/t10?,11?,16?,17-/m1/s1 |
| InChIKey | CTHKVNARXODASS-DUTCDRGVSA-N |
| XLogP | 2.44 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|