C15H17N3O3 — CID 146035732
N-[(3R)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]furo[2,3-c]pyridine-5-carboxamide (PubChem CID 146035732) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[(3R)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]furo[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]furo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 146035732 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(3R)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]furo[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(N[C@H]1C[N+]2([O-])CCC1CC2)c1cc2ccoc2cn1 |
| InChI | InChI=1S/C15H17N3O3/c19-15(12-7-11-3-6-21-14(11)8-16-12)17-13-9-18(20)4-1-10(13)2-5-18/h3,6-8,10,13H,1-2,4-5,9H2,(H,17,19)/t10?,13-,18?/m0/s1 |
| InChIKey | PZHMSMZUPNXYMC-GHIVCGBISA-N |
| XLogP | 1.66 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|