C9H8N2O2 — CID 84767089
2-amino-1-furo[2,3-c]pyridin-5-ylethanone (PubChem CID 84767089) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-amino-1-furo[2,3-c]pyridin-5-ylethanone.
| Compound Name | 2-amino-1-furo[2,3-c]pyridin-5-ylethanone |
|---|---|
| PubChem CID | 84767089 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-amino-1-furo[2,3-c]pyridin-5-ylethanone |
| SMILES | NCC(=O)c1cc2ccoc2cn1 |
| InChI | InChI=1S/C9H8N2O2/c10-4-8(12)7-3-6-1-2-13-9(6)5-11-7/h1-3,5H,4,10H2 |
| InChIKey | MBSHETAIYJKPPQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |