C22H27N5 — CID 121415023
1-(2-phenylethyl)-4-[1-(1H-pyrazol-5-yl)-1-pyridin-4-ylethyl]piperazine (PubChem CID 121415023) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-(2-phenylethyl)-4-[1-(1H-pyrazol-5-yl)-1-pyridin-4-ylethyl]piperazine.
| Compound Name | 1-(2-phenylethyl)-4-[1-(1H-pyrazol-5-yl)-1-pyridin-4-ylethyl]piperazine |
|---|---|
| PubChem CID | 121415023 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-(2-phenylethyl)-4-[1-(1H-pyrazol-5-yl)-1-pyridin-4-ylethyl]piperazine |
| SMILES | CC(c1ccncc1)(c1ccn[nH]1)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N5/c1-22(21-9-13-24-25-21,20-7-11-23-12-8-20)27-17-15-26(16-18-27)14-10-19-5-3-2-4-6-19/h2-9,11-13H,10,14-18H2,1H3,(H,24,25) |
| InChIKey | DXCXEXLSMKWVPH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |