C30H22F3NO3 — CID 121415612
2,2,2-trifluoro-N-[5-phenylmethoxy-2-[2-(4-phenylmethoxyphenyl)ethynyl]phenyl]acetamide (PubChem CID 121415612) has the molecular formula C30H22F3NO3 and a molecular weight of 501.50 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-phenylmethoxy-2-[2-(4-phenylmethoxyphenyl)ethynyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-phenylmethoxy-2-[2-(4-phenylmethoxyphenyl)ethynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 121415612 |
| Molecular Formula | C30H22F3NO3 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-phenylmethoxy-2-[2-(4-phenylmethoxyphenyl)ethynyl]phenyl]acetamide |
| SMILES | O=C(Nc1cc(OCc2ccccc2)ccc1C#Cc1ccc(OCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H22F3NO3/c31-30(32,33)29(35)34-28-19-27(37-21-24-9-5-2-6-10-24)18-15-25(28)14-11-22-12-16-26(17-13-22)36-20-23-7-3-1-4-8-23/h1-10,12-13,15-19H,20-21H2,(H,34,35) |
| InChIKey | LNMGLVUSOJGRBI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|