C16H19N5O — CID 121417327
[(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 121417327) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 121417327 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccccc1-n1nccn1)N1CC[C@H]2CCN[C@H]2C1 |
| InChI | InChI=1S/C16H19N5O/c22-16(20-10-6-12-5-7-17-14(12)11-20)13-3-1-2-4-15(13)21-18-8-9-19-21/h1-4,8-9,12,14,17H,5-7,10-11H2/t12-,14+/m1/s1 |
| InChIKey | WPNJKRFWNAPGHY-OCCSQVGLSA-N |
| XLogP | 1.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |