C23H24F3N7O2 — CID 121417329
[(3aR,7aR)-1-[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pyrazin-2-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 121417329) has the molecular formula C23H24F3N7O2 and a molecular weight of 487.49 g/mol. Its IUPAC name is [(3aR,7aR)-1-[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pyrazin-2-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(3aR,7aR)-1-[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pyrazin-2-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 121417329 |
| Molecular Formula | C23H24F3N7O2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [(3aR,7aR)-1-[6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pyrazin-2-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | CC(O)(c1cncc(N2CC[C@@H]3CCN(C(=O)c4ccccc4-n4nccn4)C[C@@H]32)n1)C(F)(F)F |
| InChI | InChI=1S/C23H24F3N7O2/c1-22(35,23(24,25)26)19-12-27-13-20(30-19)32-11-7-15-6-10-31(14-18(15)32)21(34)16-4-2-3-5-17(16)33-28-8-9-29-33/h2-5,8-9,12-13,15,18,35H,6-7,10-11,14H2,1H3/t15-,18-,22?/m0/s1 |
| InChIKey | CUGIZDREMFDCOX-CIQNTRFYSA-N |
| XLogP | 2.57 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |