C22H25N7O — CID 140857031
[(3aR,7aR)-1-(3,6-dimethylpyrazin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 140857031) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is [(3aR,7aR)-1-(3,6-dimethylpyrazin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(3aR,7aR)-1-(3,6-dimethylpyrazin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 140857031 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [(3aR,7aR)-1-(3,6-dimethylpyrazin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | Cc1cnc(C)c(N2CC[C@@H]3CCN(C(=O)c4ccccc4-n4nccn4)C[C@@H]32)n1 |
| InChI | InChI=1S/C22H25N7O/c1-15-13-23-16(2)21(26-15)28-12-8-17-7-11-27(14-20(17)28)22(30)18-5-3-4-6-19(18)29-24-9-10-25-29/h3-6,9-10,13,17,20H,7-8,11-12,14H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | MEPQDTBMMQJUNL-PXNSSMCTSA-N |
| XLogP | 2.42 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |