C45H33N — CID 121419327
6-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphthalen-2-amine (PubChem CID 121419327) has the molecular formula C45H33N and a molecular weight of 592.80 g/mol. Its IUPAC name is 6-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphthalen-2-amine.
| Compound Name | 6-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 121419327 |
| Molecular Formula | C45H33N |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 6-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphthalen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc3cc(-c4cc5c6c(ccc7cccc(c76)C5(C)C)c4)ccc3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H33N/c1-45(2)41-15-9-12-32-16-19-36-27-37(29-42(45)44(36)43(32)41)34-17-18-35-28-40(25-22-33(35)26-34)46(38-13-7-4-8-14-38)39-23-20-31(21-24-39)30-10-5-3-6-11-30/h3-29H,1-2H3/i4D,7D,8D,13D,14D |
| InChIKey | CDRANUROMRYZEX-KVKRPVSRSA-N |
| XLogP | 12.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|