C22H24N2O9 — CID 121424484
dimethyl 3-methoxy-4-oxo-1-[(3R,4S)-4-(phenylmethoxycarbonylamino)oxolan-3-yl]pyridine-2,5-dicarboxylate (PubChem CID 121424484) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is dimethyl 3-methoxy-4-oxo-1-[(3R,4S)-4-(phenylmethoxycarbonylamino)oxolan-3-yl]pyridine-2,5-dicarboxylate.
| Compound Name | dimethyl 3-methoxy-4-oxo-1-[(3R,4S)-4-(phenylmethoxycarbonylamino)oxolan-3-yl]pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 121424484 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | dimethyl 3-methoxy-4-oxo-1-[(3R,4S)-4-(phenylmethoxycarbonylamino)oxolan-3-yl]pyridine-2,5-dicarboxylate |
| SMILES | COC(=O)c1cn([C@H]2COC[C@H]2NC(=O)OCc2ccccc2)c(C(=O)OC)c(OC)c1=O |
| InChI | InChI=1S/C22H24N2O9/c1-29-19-17(21(27)31-3)24(9-14(18(19)25)20(26)30-2)16-12-32-11-15(16)23-22(28)33-10-13-7-5-4-6-8-13/h4-9,15-16H,10-12H2,1-3H3,(H,23,28)/t15-,16+/m1/s1 |
| InChIKey | MCOMVZQCXSJELX-CVEARBPZSA-N |
| XLogP | 1.30 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|