C20H23F3N4O2 — CID 121427993
[2-(4-ethyl-5-methyl-1,3-oxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,2,2-trifluoroethyl)-3-pyridinyl]methanone (PubChem CID 121427993) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is [2-(4-ethyl-5-methyl-1,3-oxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,2,2-trifluoroethyl)-3-pyridinyl]methanone.
| Compound Name | [2-(4-ethyl-5-methyl-1,3-oxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,2,2-trifluoroethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 121427993 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-(4-ethyl-5-methyl-1,3-oxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,2,2-trifluoroethyl)-3-pyridinyl]methanone |
| SMILES | CCc1nc(N2CC3CN(C(=O)c4cccnc4CC(F)(F)F)CC3C2)oc1C |
| InChI | InChI=1S/C20H23F3N4O2/c1-3-16-12(2)29-19(25-16)27-10-13-8-26(9-14(13)11-27)18(28)15-5-4-6-24-17(15)7-20(21,22)23/h4-6,13-14H,3,7-11H2,1-2H3 |
| InChIKey | SVPWLOCWGJHUEZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |