C22H25N5O2 — CID 121428620
(5S,9Z)-13-ethyl-6,6-dimethyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),9,11,14,16-pentaen-3-one (PubChem CID 121428620) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is (5S,9Z)-13-ethyl-6,6-dimethyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),9,11,14,16-pentaen-3-one.
| Compound Name | (5S,9Z)-13-ethyl-6,6-dimethyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),9,11,14,16-pentaen-3-one |
|---|---|
| PubChem CID | 121428620 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (5S,9Z)-13-ethyl-6,6-dimethyl-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),9,11,14,16-pentaen-3-one |
| SMILES | CCn1ncc2cc3nc(c21)/C=C\COC(C)(C)[C@H](c1ccccc1)NC(=O)N3 |
| InChI | InChI=1S/C22H25N5O2/c1-4-27-19-16(14-23-27)13-18-24-17(19)11-8-12-29-22(2,3)20(26-21(28)25-18)15-9-6-5-7-10-15/h5-11,13-14,20H,4,12H2,1-3H3,(H2,24,25,26,28)/b11-8-/t20-/m0/s1 |
| InChIKey | UBKITLSETNCEQV-WUQYLLKWSA-N |
| XLogP | 4.14 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |