C23H24F3N9O3 — CID 121430136
4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide (PubChem CID 121430136) has the molecular formula C23H24F3N9O3 and a molecular weight of 531.50 g/mol. Its IUPAC name is 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 121430136 |
| Molecular Formula | C23H24F3N9O3 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 4-[(1-cyanocyclopropyl)methoxy]-6-[4-(4-methoxy-2H-pyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide |
| SMILES | COc1ccnc2n[nH]c(C3CCN(c4nc(OCC5(C#N)CC5)nc(C(=O)NCC(F)(F)F)n4)CC3)c12 |
| InChI | InChI=1S/C23H24F3N9O3/c1-37-14-2-7-28-17-15(14)16(33-34-17)13-3-8-35(9-4-13)20-30-18(19(36)29-11-23(24,25)26)31-21(32-20)38-12-22(10-27)5-6-22/h2,7,13H,3-6,8-9,11-12H2,1H3,(H,29,36)(H,28,33,34) |
| InChIKey | KSUAKJRVYBTTOR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 154.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |