C17H20ClN3O4 — CID 121433433
tert-butyl (2S)-2-(5-chloro-7-nitro-1H-indol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 121433433) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is tert-butyl (2S)-2-(5-chloro-7-nitro-1H-indol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(5-chloro-7-nitro-1H-indol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121433433 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | tert-butyl (2S)-2-(5-chloro-7-nitro-1H-indol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1cc2cc(Cl)cc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-17(2,3)25-16(22)20-6-4-5-13(20)12-8-10-7-11(18)9-14(21(23)24)15(10)19-12/h7-9,13,19H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | HAPFGIAIHSAWRJ-ZDUSSCGKSA-N |
| XLogP | 4.80 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|