C11H22N2O3 — CID 121434520
2-cyanopentan-2-ylcarbamic acid;2-methylpropan-2-ol (PubChem CID 121434520) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-cyanopentan-2-ylcarbamic acid;2-methylpropan-2-ol.
| Compound Name | 2-cyanopentan-2-ylcarbamic acid;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 121434520 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-cyanopentan-2-ylcarbamic acid;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCCC(C)(C#N)NC(=O)O |
| InChI | InChI=1S/C7H12N2O2.C4H10O/c1-3-4-7(2,5-8)9-6(10)11;1-4(2,3)5/h9H,3-4H2,1-2H3,(H,10,11);5H,1-3H3 |
| InChIKey | QBXAJPDPYWKQHR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |