C13H13ClF2N2O — CID 166404805
3-chloro-N-(2-cyanopentan-2-yl)-2,4-difluorobenzamide (PubChem CID 166404805) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is 3-chloro-N-(2-cyanopentan-2-yl)-2,4-difluorobenzamide.
| Compound Name | 3-chloro-N-(2-cyanopentan-2-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 166404805 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-chloro-N-(2-cyanopentan-2-yl)-2,4-difluorobenzamide |
| SMILES | CCCC(C)(C#N)NC(=O)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C13H13ClF2N2O/c1-3-6-13(2,7-17)18-12(19)8-4-5-9(15)10(14)11(8)16/h4-5H,3,6H2,1-2H3,(H,18,19) |
| InChIKey | OVSXKYHBAAKMCY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|