C19H23ClN6O3 — CID 121437182
5-N-(3-chlorophenyl)-3-N-methyl-3-N-(1-methylazetidin-3-yl)oxy-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide (PubChem CID 121437182) has the molecular formula C19H23ClN6O3 and a molecular weight of 418.89 g/mol. Its IUPAC name is 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(1-methylazetidin-3-yl)oxy-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(1-methylazetidin-3-yl)oxy-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 121437182 |
| Molecular Formula | C19H23ClN6O3 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(1-methylazetidin-3-yl)oxy-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
| SMILES | CN1CC(ON(C)C(=O)c2n[nH]c3c2CN(C(=O)Nc2cccc(Cl)c2)CC3)C1 |
| InChI | InChI=1S/C19H23ClN6O3/c1-24-9-14(10-24)29-25(2)18(27)17-15-11-26(7-6-16(15)22-23-17)19(28)21-13-5-3-4-12(20)8-13/h3-5,8,14H,6-7,9-11H2,1-2H3,(H,21,28)(H,22,23) |
| InChIKey | KIMDVDXYBVMTDY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|