C23H43N3O5 — CID 121445130
tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2-methylbutanoyl]amino]hex-3-enyl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate (PubChem CID 121445130) has the molecular formula C23H43N3O5 and a molecular weight of 441.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2-methylbutanoyl]amino]hex-3-enyl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2-methylbutanoyl]amino]hex-3-enyl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 121445130 |
| Molecular Formula | C23H43N3O5 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2-methylbutanoyl]amino]hex-3-enyl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]carbamate |
| SMILES | CC[C@H](C)C(=O)NCC/C=C\CCNC(=O)[C@H](COC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H43N3O5/c1-9-17(2)19(27)24-14-12-10-11-13-15-25-20(28)18(16-30-22(3,4)5)26-21(29)31-23(6,7)8/h10-11,17-18H,9,12-16H2,1-8H3,(H,24,27)(H,25,28)(H,26,29)/b11-10-/t17-,18-/m0/s1 |
| InChIKey | SSNYEUKJFKDRJL-JSSIJEINSA-N |
| XLogP | 3.31 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|