C12H16ClN5O2 — CID 121446196
5-[(1-chloro-4-hydroxypiperidin-4-yl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 121446196) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 5-[(1-chloro-4-hydroxypiperidin-4-yl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[(1-chloro-4-hydroxypiperidin-4-yl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 121446196 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[(1-chloro-4-hydroxypiperidin-4-yl)methyl]-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1ncc2c(=O)n(CC3(O)CCN(Cl)CC3)cnc21 |
| InChI | InChI=1S/C12H16ClN5O2/c1-16-10-9(6-15-16)11(19)17(8-14-10)7-12(20)2-4-18(13)5-3-12/h6,8,20H,2-5,7H2,1H3 |
| InChIKey | HGWGHIXOVWTFLH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|