C17H27NO — CID 121446400
1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbutan-1-one (PubChem CID 121446400) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbutan-1-one.
| Compound Name | 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 121446400 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbutan-1-one |
| SMILES | CCC(C)(C)C(=O)N1C=CC=CC1C1CCCCC1 |
| InChI | InChI=1S/C17H27NO/c1-4-17(2,3)16(19)18-13-9-8-12-15(18)14-10-6-5-7-11-14/h8-9,12-15H,4-7,10-11H2,1-3H3 |
| InChIKey | MDZIWBZBWSSUEH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |