C10H21F — CID 121449647
1,1,1,5,5,5-hexadeuterio-3-fluoro-2,3,4-trimethyl-2,4-bis(trideuteriomethyl)pentane (PubChem CID 121449647) has the molecular formula C10H21F and a molecular weight of 172.35 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexadeuterio-3-fluoro-2,3,4-trimethyl-2,4-bis(trideuteriomethyl)pentane.
| Compound Name | 1,1,1,5,5,5-hexadeuterio-3-fluoro-2,3,4-trimethyl-2,4-bis(trideuteriomethyl)pentane |
|---|---|
| PubChem CID | 121449647 |
| Molecular Formula | C10H21F |
| Molecular Weight | 172.35 g/mol |
| Exact Mass | 172.24 |
| IUPAC Name | 1,1,1,5,5,5-hexadeuterio-3-fluoro-2,3,4-trimethyl-2,4-bis(trideuteriomethyl)pentane |
| SMILES | [2H]C([2H])([2H])C(C)(C([2H])([2H])[2H])C(C)(F)C(C)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H21F/c1-8(2,3)10(7,11)9(4,5)6/h1-7H3/i1D3,2D3,4D3,5D3 |
| InChIKey | WOEWTSMJAOITGS-NYOJSUJRSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |