C24H29BrN2O8S2 — CID 121449889
2-[6-bromo-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid (PubChem CID 121449889) has the molecular formula C24H29BrN2O8S2 and a molecular weight of 617.54 g/mol. Its IUPAC name is 2-[6-bromo-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid.
| Compound Name | 2-[6-bromo-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121449889 |
| Molecular Formula | C24H29BrN2O8S2 |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | 2-[6-bromo-1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid |
| SMILES | COc1ccccc1[C@H](CN1c2sc(Br)c(C)c2C(=O)N(C(C)(C)C(=O)O)S1(=O)=O)OC1CCOCC1 |
| InChI | InChI=1S/C24H29BrN2O8S2/c1-14-19-21(28)27(24(2,3)23(29)30)37(31,32)26(22(19)36-20(14)25)13-18(35-15-9-11-34-12-10-15)16-7-5-6-8-17(16)33-4/h5-8,15,18H,9-13H2,1-4H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | FKCWDQDKDHTTIR-SFHVURJKSA-N |
| XLogP | 4.13 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |