C27H31FN4O8S2 — CID 121449879
2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanamide (PubChem CID 121449879) has the molecular formula C27H31FN4O8S2 and a molecular weight of 622.70 g/mol. Its IUPAC name is 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanamide.
| Compound Name | 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 121449879 |
| Molecular Formula | C27H31FN4O8S2 |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 2-[1-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanamide |
| SMILES | COc1ccc(F)cc1[C@H](CN1c2sc(-c3ncco3)c(C)c2C(=O)N(C(C)(C)C(N)=O)S1(=O)=O)OC1CCOCC1 |
| InChI | InChI=1S/C27H31FN4O8S2/c1-15-21-24(33)32(27(2,3)26(29)34)42(35,36)31(25(21)41-22(15)23-30-9-12-39-23)14-20(40-17-7-10-38-11-8-17)18-13-16(28)5-6-19(18)37-4/h5-6,9,12-13,17,20H,7-8,10-11,14H2,1-4H3,(H2,29,34)/t20-/m0/s1 |
| InChIKey | ZBJMAOGDJJTRFD-FQEVSTJZSA-N |
| XLogP | 3.57 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |