C25H31N3O8S2 — CID 144744495
2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid;propan-2-ol (PubChem CID 144744495) has the molecular formula C25H31N3O8S2 and a molecular weight of 565.67 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid;propan-2-ol.
| Compound Name | 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid;propan-2-ol |
|---|---|
| PubChem CID | 144744495 |
| Molecular Formula | C25H31N3O8S2 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]-2-methylpropanoic acid;propan-2-ol |
| SMILES | CC(C)O.COc1ccccc1CCN1c2sc(-c3ncco3)c(C)c2C(=O)N(C(C)(C)C(=O)O)S1(=O)=O |
| InChI | InChI=1S/C22H23N3O7S2.C3H8O/c1-13-16-19(26)25(22(2,3)21(27)28)34(29,30)24(11-9-14-7-5-6-8-15(14)31-4)20(16)33-17(13)18-23-10-12-32-18;1-3(2)4/h5-8,10,12H,9,11H2,1-4H3,(H,27,28);3-4H,1-2H3 |
| InChIKey | HOCGIJZBDANEON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |