C15H20N2 — CID 121450481
N,2-dimethyl-N-(quinolin-8-ylmethyl)propan-2-amine (PubChem CID 121450481) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,2-dimethyl-N-(quinolin-8-ylmethyl)propan-2-amine.
| Compound Name | N,2-dimethyl-N-(quinolin-8-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 121450481 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N,2-dimethyl-N-(quinolin-8-ylmethyl)propan-2-amine |
| SMILES | CN(Cc1cccc2cccnc12)C(C)(C)C |
| InChI | InChI=1S/C15H20N2/c1-15(2,3)17(4)11-13-8-5-7-12-9-6-10-16-14(12)13/h5-10H,11H2,1-4H3 |
| InChIKey | KKDKGGVDPBBFTR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |