About 8-but-2-ynylquinoline
8-but-2-ynylquinoline (PubChem CID 134164519) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 8-but-2-ynylquinoline.
Molecular Properties
| Compound Name | 8-but-2-ynylquinoline |
| PubChem CID | 134164519 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 8-but-2-ynylquinoline |
| SMILES | CC#CCc1cccc2cccnc12 |
| InChI | InChI=1S/C13H11N/c1-2-3-6-11-7-4-8-12-9-5-10-14-13(11)12/h4-5,7-10H,6H2,1H3 |
| InChIKey | QTXRQSDFQCLUAP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-but-2-ynylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-2-ynylquinoline?
The IUPAC name of 8-but-2-ynylquinoline (CID 134164519) is 8-but-2-ynylquinoline.
What is the SMILES notation for 8-but-2-ynylquinoline?
The canonical SMILES for 8-but-2-ynylquinoline is CC#CCc1cccc2cccnc12.
What is the InChIKey of 8-but-2-ynylquinoline?
The InChIKey is QTXRQSDFQCLUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-3-6-11-7-4-8-12-9-5-10-14-13(11)12/h4-5,7-10H,6H2,1H3.
What are the key properties of 8-but-2-ynylquinoline?
8-but-2-ynylquinoline has a molecular weight of 181.24 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-2-ynylquinoline is sourced from PubChem (CID 134164519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).