C10H24N4 — CID 121450916
1-methyl-1-[(2R,6R)-6-(methylamino)heptan-2-yl]guanidine (PubChem CID 121450916) has the molecular formula C10H24N4 and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-methyl-1-[(2R,6R)-6-(methylamino)heptan-2-yl]guanidine.
| Compound Name | 1-methyl-1-[(2R,6R)-6-(methylamino)heptan-2-yl]guanidine |
|---|---|
| PubChem CID | 121450916 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | 1-methyl-1-[(2R,6R)-6-(methylamino)heptan-2-yl]guanidine |
| SMILES | [H]/N=C(\N)N(C)[C@H](C)CCC[C@@H](C)NC |
| InChI | InChI=1S/C10H24N4/c1-8(13-3)6-5-7-9(2)14(4)10(11)12/h8-9,13H,5-7H2,1-4H3,(H3,11,12)/t8-,9-/m1/s1 |
| InChIKey | KZIHEWNHGULCKT-RKDXNWHRSA-N |
| XLogP | 0.98 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|