C8H18N4O2 — CID 54046473
(2S)-5-[carbamimidoyl(methyl)amino]-2-(methylamino)pentanoic acid (PubChem CID 54046473) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is (2S)-5-[carbamimidoyl(methyl)amino]-2-(methylamino)pentanoic acid.
| Compound Name | (2S)-5-[carbamimidoyl(methyl)amino]-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 54046473 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (2S)-5-[carbamimidoyl(methyl)amino]-2-(methylamino)pentanoic acid |
| SMILES | [H]/N=C(\N)N(C)CCC[C@H](NC)C(=O)O |
| InChI | InChI=1S/C8H18N4O2/c1-11-6(7(13)14)4-3-5-12(2)8(9)10/h6,11H,3-5H2,1-2H3,(H3,9,10)(H,13,14)/t6-/m0/s1 |
| InChIKey | LPXQXJCKIVPYEJ-LURJTMIESA-N |
| XLogP | -0.74 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|